C13H18N4O4 — CID 142041894
2-(oxomethylidene)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione (PubChem CID 142041894) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-(oxomethylidene)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione.
| Compound Name | 2-(oxomethylidene)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione |
|---|---|
| PubChem CID | 142041894 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-(oxomethylidene)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione |
| SMILES | O=C=C1CNC(=O)CNC(=O)CNC(=O)C2CCCCN12 |
| InChI | InChI=1S/C13H18N4O4/c18-8-9-5-14-11(19)6-15-12(20)7-16-13(21)10-3-1-2-4-17(9)10/h10H,1-7H2,(H,14,19)(H,15,20)(H,16,21) |
| InChIKey | RTCHEUXAFXGJOT-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|