C26H22N2O4 — CID 142042228
2-[(2-hydroxy-3-methoxyphenyl)methyl]-5-phenylmethoxy-9H-pyrido[3,4-b]indol-1-one (PubChem CID 142042228) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-[(2-hydroxy-3-methoxyphenyl)methyl]-5-phenylmethoxy-9H-pyrido[3,4-b]indol-1-one.
| Compound Name | 2-[(2-hydroxy-3-methoxyphenyl)methyl]-5-phenylmethoxy-9H-pyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 142042228 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 2-[(2-hydroxy-3-methoxyphenyl)methyl]-5-phenylmethoxy-9H-pyrido[3,4-b]indol-1-one |
| SMILES | COc1cccc(Cn2ccc3c([nH]c4cccc(OCc5ccccc5)c43)c2=O)c1O |
| InChI | InChI=1S/C26H22N2O4/c1-31-22-12-5-9-18(25(22)29)15-28-14-13-19-23-20(27-24(19)26(28)30)10-6-11-21(23)32-16-17-7-3-2-4-8-17/h2-14,27,29H,15-16H2,1H3 |
| InChIKey | AWLNUVABXJGOMK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|