C26H20N2O3 — CID 66604014
methyl 2-phenyl-9-phenylmethoxy-5H-pyrido[3,2-b]indole-4-carboxylate (PubChem CID 66604014) has the molecular formula C26H20N2O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is methyl 2-phenyl-9-phenylmethoxy-5H-pyrido[3,2-b]indole-4-carboxylate.
| Compound Name | methyl 2-phenyl-9-phenylmethoxy-5H-pyrido[3,2-b]indole-4-carboxylate |
|---|---|
| PubChem CID | 66604014 |
| Molecular Formula | C26H20N2O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | methyl 2-phenyl-9-phenylmethoxy-5H-pyrido[3,2-b]indole-4-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)nc2c1[nH]c1cccc(OCc3ccccc3)c12 |
| InChI | InChI=1S/C26H20N2O3/c1-30-26(29)19-15-21(18-11-6-3-7-12-18)28-25-23-20(27-24(19)25)13-8-14-22(23)31-16-17-9-4-2-5-10-17/h2-15,27H,16H2,1H3 |
| InChIKey | LOCBGJIZVNCPLV-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |