C29H25NO4 — CID 126751106
methyl 8-ethyl-2-(3-methyl-1-benzofuran-2-yl)-5-phenylmethoxyquinoline-4-carboxylate (PubChem CID 126751106) has the molecular formula C29H25NO4 and a molecular weight of 451.52 g/mol. Its IUPAC name is methyl 8-ethyl-2-(3-methyl-1-benzofuran-2-yl)-5-phenylmethoxyquinoline-4-carboxylate.
| Compound Name | methyl 8-ethyl-2-(3-methyl-1-benzofuran-2-yl)-5-phenylmethoxyquinoline-4-carboxylate |
|---|---|
| PubChem CID | 126751106 |
| Molecular Formula | C29H25NO4 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | methyl 8-ethyl-2-(3-methyl-1-benzofuran-2-yl)-5-phenylmethoxyquinoline-4-carboxylate |
| SMILES | CCc1ccc(OCc2ccccc2)c2c(C(=O)OC)cc(-c3oc4ccccc4c3C)nc12 |
| InChI | InChI=1S/C29H25NO4/c1-4-20-14-15-25(33-17-19-10-6-5-7-11-19)26-22(29(31)32-3)16-23(30-27(20)26)28-18(2)21-12-8-9-13-24(21)34-28/h5-16H,4,17H2,1-3H3 |
| InChIKey | DBQIAPQNSNFWBY-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |