C28H22ClNO3 — CID 126751272
8-ethyl-2-(3-methyl-1-benzofuran-2-yl)-5-phenylmethoxyquinoline-4-carbonyl chloride (PubChem CID 126751272) has the molecular formula C28H22ClNO3 and a molecular weight of 455.94 g/mol. Its IUPAC name is 8-ethyl-2-(3-methyl-1-benzofuran-2-yl)-5-phenylmethoxyquinoline-4-carbonyl chloride.
| Compound Name | 8-ethyl-2-(3-methyl-1-benzofuran-2-yl)-5-phenylmethoxyquinoline-4-carbonyl chloride |
|---|---|
| PubChem CID | 126751272 |
| Molecular Formula | C28H22ClNO3 |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 8-ethyl-2-(3-methyl-1-benzofuran-2-yl)-5-phenylmethoxyquinoline-4-carbonyl chloride |
| SMILES | CCc1ccc(OCc2ccccc2)c2c(C(=O)Cl)cc(-c3oc4ccccc4c3C)nc12 |
| InChI | InChI=1S/C28H22ClNO3/c1-3-19-13-14-24(32-16-18-9-5-4-6-10-18)25-21(28(29)31)15-22(30-26(19)25)27-17(2)20-11-7-8-12-23(20)33-27/h4-15H,3,16H2,1-2H3 |
| InChIKey | LGTKUKBDZVEGQD-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|