C24H23NO4 — CID 129027925
5-butoxy-7-methyl-2-(3-methyl-1-benzofuran-2-yl)quinoline-4-carboxylic acid (PubChem CID 129027925) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is 5-butoxy-7-methyl-2-(3-methyl-1-benzofuran-2-yl)quinoline-4-carboxylic acid.
| Compound Name | 5-butoxy-7-methyl-2-(3-methyl-1-benzofuran-2-yl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 129027925 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 5-butoxy-7-methyl-2-(3-methyl-1-benzofuran-2-yl)quinoline-4-carboxylic acid |
| SMILES | CCCCOc1cc(C)cc2nc(-c3oc4ccccc4c3C)cc(C(=O)O)c12 |
| InChI | InChI=1S/C24H23NO4/c1-4-5-10-28-21-12-14(2)11-18-22(21)17(24(26)27)13-19(25-18)23-15(3)16-8-6-7-9-20(16)29-23/h6-9,11-13H,4-5,10H2,1-3H3,(H,26,27) |
| InChIKey | FPUAEKGLQTZNLO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|