C22H41NO — CID 142043044
1-[6-[1-[2,6-di(propan-2-yl)cyclohex-2-en-1-yl]propan-2-yl]piperidin-2-yl]ethanol (PubChem CID 142043044) has the molecular formula C22H41NO and a molecular weight of 335.58 g/mol. Its IUPAC name is 1-[6-[1-[2,6-di(propan-2-yl)cyclohex-2-en-1-yl]propan-2-yl]piperidin-2-yl]ethanol.
| Compound Name | 1-[6-[1-[2,6-di(propan-2-yl)cyclohex-2-en-1-yl]propan-2-yl]piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 142043044 |
| Molecular Formula | C22H41NO |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.32 |
| IUPAC Name | 1-[6-[1-[2,6-di(propan-2-yl)cyclohex-2-en-1-yl]propan-2-yl]piperidin-2-yl]ethanol |
| SMILES | CC(C)C1=CCCC(C(C)C)C1CC(C)C1CCCC(C(C)O)N1 |
| InChI | InChI=1S/C22H41NO/c1-14(2)18-9-7-10-19(15(3)4)20(18)13-16(5)21-11-8-12-22(23-21)17(6)24/h9,14-17,19-24H,7-8,10-13H2,1-6H3 |
| InChIKey | ZUCAJBSZOYIMQZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|