C26H47NO3 — CID 91242739
5-cyclopropyl-2-[[2-[3-hydroxy-2-(2-propan-2-ylbut-3-enylamino)butyl]cyclohexylidene]methyl]pentane-1,1-diol (PubChem CID 91242739) has the molecular formula C26H47NO3 and a molecular weight of 421.67 g/mol. Its IUPAC name is 5-cyclopropyl-2-[[2-[3-hydroxy-2-(2-propan-2-ylbut-3-enylamino)butyl]cyclohexylidene]methyl]pentane-1,1-diol.
| Compound Name | 5-cyclopropyl-2-[[2-[3-hydroxy-2-(2-propan-2-ylbut-3-enylamino)butyl]cyclohexylidene]methyl]pentane-1,1-diol |
|---|---|
| PubChem CID | 91242739 |
| Molecular Formula | C26H47NO3 |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.36 |
| IUPAC Name | 5-cyclopropyl-2-[[2-[3-hydroxy-2-(2-propan-2-ylbut-3-enylamino)butyl]cyclohexylidene]methyl]pentane-1,1-diol |
| SMILES | C=CC(CNC(CC1CCCCC1=CC(CCCC1CC1)C(O)O)C(C)O)C(C)C |
| InChI | InChI=1S/C26H47NO3/c1-5-21(18(2)3)17-27-25(19(4)28)16-23-11-7-6-10-22(23)15-24(26(29)30)12-8-9-20-13-14-20/h5,15,18-21,23-30H,1,6-14,16-17H2,2-4H3 |
| InChIKey | YPPWNVVMRUYEOL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|