C18H31NO3 — CID 142163734
2-[[(1S)-3-cyclohexa-1,5-dien-1-yl-1-[(2R)-2-hydroxycyclopropyl]propyl]amino]-3-methylpentane-1,1-diol (PubChem CID 142163734) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is 2-[[(1S)-3-cyclohexa-1,5-dien-1-yl-1-[(2R)-2-hydroxycyclopropyl]propyl]amino]-3-methylpentane-1,1-diol.
| Compound Name | 2-[[(1S)-3-cyclohexa-1,5-dien-1-yl-1-[(2R)-2-hydroxycyclopropyl]propyl]amino]-3-methylpentane-1,1-diol |
|---|---|
| PubChem CID | 142163734 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 2-[[(1S)-3-cyclohexa-1,5-dien-1-yl-1-[(2R)-2-hydroxycyclopropyl]propyl]amino]-3-methylpentane-1,1-diol |
| SMILES | CCC(C)C(N[C@@H](CCC1=CCCC=C1)C1C[C@H]1O)C(O)O |
| InChI | InChI=1S/C18H31NO3/c1-3-12(2)17(18(21)22)19-15(14-11-16(14)20)10-9-13-7-5-4-6-8-13/h5,7-8,12,14-22H,3-4,6,9-11H2,1-2H3/t12?,14?,15-,16+,17?/m0/s1 |
| InChIKey | JKAVPFALDSNYDS-QJWJEEMBSA-N |
| XLogP | 2.11 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|