C20H31NO3 — CID 142141633
[1-[(4-cyclohexa-1,3-dien-1-yl-1-hydroxybutan-2-yl)amino]-2-cyclohex-3-en-1-ylcyclopropyl]methanediol (PubChem CID 142141633) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is [1-[(4-cyclohexa-1,3-dien-1-yl-1-hydroxybutan-2-yl)amino]-2-cyclohex-3-en-1-ylcyclopropyl]methanediol.
| Compound Name | [1-[(4-cyclohexa-1,3-dien-1-yl-1-hydroxybutan-2-yl)amino]-2-cyclohex-3-en-1-ylcyclopropyl]methanediol |
|---|---|
| PubChem CID | 142141633 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | [1-[(4-cyclohexa-1,3-dien-1-yl-1-hydroxybutan-2-yl)amino]-2-cyclohex-3-en-1-ylcyclopropyl]methanediol |
| SMILES | OCC(CCC1=CC=CCC1)NC1(C(O)O)CC1C1CC=CCC1 |
| InChI | InChI=1S/C20H31NO3/c22-14-17(12-11-15-7-3-1-4-8-15)21-20(19(23)24)13-18(20)16-9-5-2-6-10-16/h1-3,5,7,16-19,21-24H,4,6,8-14H2 |
| InChIKey | KNCBTLQSNSGPKC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|