C15H27NO2 — CID 163831395
(E,2R,3S)-4-cyclobutyl-3-methyl-2-(methylamino)-5-[(1R,2S)-2-methylcyclopropyl]pent-4-ene-1,1-diol (PubChem CID 163831395) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is (E,2R,3S)-4-cyclobutyl-3-methyl-2-(methylamino)-5-[(1R,2S)-2-methylcyclopropyl]pent-4-ene-1,1-diol.
| Compound Name | (E,2R,3S)-4-cyclobutyl-3-methyl-2-(methylamino)-5-[(1R,2S)-2-methylcyclopropyl]pent-4-ene-1,1-diol |
|---|---|
| PubChem CID | 163831395 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (E,2R,3S)-4-cyclobutyl-3-methyl-2-(methylamino)-5-[(1R,2S)-2-methylcyclopropyl]pent-4-ene-1,1-diol |
| SMILES | CN[C@@H](C(O)O)[C@@H](C)/C(=C/[C@@H]1C[C@@H]1C)C1CCC1 |
| InChI | InChI=1S/C15H27NO2/c1-9-7-12(9)8-13(11-5-4-6-11)10(2)14(16-3)15(17)18/h8-12,14-18H,4-7H2,1-3H3/b13-8-/t9-,10-,12-,14+/m0/s1 |
| InChIKey | ODXUABLZSWABDC-OFWNJZIQSA-N |
| XLogP | 1.90 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|