C20H33N5O2 — CID 142043847
N-[(2E,3Z)-2-ethylidenehepta-3,6-dienyl]formamide;2-(3-imidazol-1-ylpropyl)-3-methyl-1,2,6-oxadiazinane (PubChem CID 142043847) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[(2E,3Z)-2-ethylidenehepta-3,6-dienyl]formamide;2-(3-imidazol-1-ylpropyl)-3-methyl-1,2,6-oxadiazinane.
| Compound Name | N-[(2E,3Z)-2-ethylidenehepta-3,6-dienyl]formamide;2-(3-imidazol-1-ylpropyl)-3-methyl-1,2,6-oxadiazinane |
|---|---|
| PubChem CID | 142043847 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | N-[(2E,3Z)-2-ethylidenehepta-3,6-dienyl]formamide;2-(3-imidazol-1-ylpropyl)-3-methyl-1,2,6-oxadiazinane |
| SMILES | C=CC/C=C\C(=C/C)CNC=O.CC1CCNON1CCCn1ccnc1 |
| InChI | InChI=1S/C10H18N4O.C10H15NO/c1-10-3-4-12-15-14(10)7-2-6-13-8-5-11-9-13;1-3-5-6-7-10(4-2)8-11-9-12/h5,8-10,12H,2-4,6-7H2,1H3;3-4,6-7,9H,1,5,8H2,2H3,(H,11,12)/b;7-6-,10-4+ |
| InChIKey | RTIXSBJCXCOBOS-SNIKKGLJSA-N |
| XLogP | 2.61 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|