C16H27N3O — CID 143246262
ethane;N-[6-(imidazol-1-ylmethyl)cyclohepta-1,6-dien-1-yl]formamide (PubChem CID 143246262) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is ethane;N-[6-(imidazol-1-ylmethyl)cyclohepta-1,6-dien-1-yl]formamide.
| Compound Name | ethane;N-[6-(imidazol-1-ylmethyl)cyclohepta-1,6-dien-1-yl]formamide |
|---|---|
| PubChem CID | 143246262 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | ethane;N-[6-(imidazol-1-ylmethyl)cyclohepta-1,6-dien-1-yl]formamide |
| SMILES | CC.CC.O=CNC1=CCCCC(Cn2ccnc2)=C1 |
| InChI | InChI=1S/C12H15N3O.2C2H6/c16-10-14-12-4-2-1-3-11(7-12)8-15-6-5-13-9-15;2*1-2/h4-7,9-10H,1-3,8H2,(H,14,16);2*1-2H3 |
| InChIKey | FCECTOHUIDGKEI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|