C17H14ClNO — CID 142044807
(3Z)-3-[(4-chlorophenyl)methylidene]-1,5-dimethylindol-2-one (PubChem CID 142044807) has the molecular formula C17H14ClNO and a molecular weight of 283.76 g/mol. Its IUPAC name is (3Z)-3-[(4-chlorophenyl)methylidene]-1,5-dimethylindol-2-one.
| Compound Name | (3Z)-3-[(4-chlorophenyl)methylidene]-1,5-dimethylindol-2-one |
|---|---|
| PubChem CID | 142044807 |
| Molecular Formula | C17H14ClNO |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (3Z)-3-[(4-chlorophenyl)methylidene]-1,5-dimethylindol-2-one |
| SMILES | Cc1ccc2c(c1)/C(=C/c1ccc(Cl)cc1)C(=O)N2C |
| InChI | InChI=1S/C17H14ClNO/c1-11-3-8-16-14(9-11)15(17(20)19(16)2)10-12-4-6-13(18)7-5-12/h3-10H,1-2H3/b15-10- |
| InChIKey | AZEPXRUBJNOCKC-GDNBJRDFSA-N |
| XLogP | 4.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|