C24H24ClNO3 — CID 70204653
(3E)-3-[[3-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]methylidene]-5-chloro-1-methylindol-2-one (PubChem CID 70204653) has the molecular formula C24H24ClNO3 and a molecular weight of 409.91 g/mol. Its IUPAC name is (3E)-3-[[3-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]methylidene]-5-chloro-1-methylindol-2-one.
| Compound Name | (3E)-3-[[3-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]methylidene]-5-chloro-1-methylindol-2-one |
|---|---|
| PubChem CID | 70204653 |
| Molecular Formula | C24H24ClNO3 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | (3E)-3-[[3-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]methylidene]-5-chloro-1-methylindol-2-one |
| SMILES | COc1ccc(/C=C2/C(=O)N(C)c3ccc(Cl)cc32)cc1O[C@H]1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C24H24ClNO3/c1-26-20-7-6-17(25)13-18(20)19(24(26)27)10-15-4-8-21(28-2)23(12-15)29-22-11-14-3-5-16(22)9-14/h4,6-8,10,12-14,16,22H,3,5,9,11H2,1-2H3/b19-10+/t14-,16+,22+/m1/s1 |
| InChIKey | FFFLXXMNEHFKKE-UKZBCVMRSA-N |
| XLogP | 5.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|