C30H35NO4 — CID 70207987
(3Z)-3-[[3-[[(2R,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]methylidene]-5-cyclopentyloxy-1-ethylindol-2-one (PubChem CID 70207987) has the molecular formula C30H35NO4 and a molecular weight of 473.61 g/mol. Its IUPAC name is (3Z)-3-[[3-[[(2R,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]methylidene]-5-cyclopentyloxy-1-ethylindol-2-one.
| Compound Name | (3Z)-3-[[3-[[(2R,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]methylidene]-5-cyclopentyloxy-1-ethylindol-2-one |
|---|---|
| PubChem CID | 70207987 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | (3Z)-3-[[3-[[(2R,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]methylidene]-5-cyclopentyloxy-1-ethylindol-2-one |
| SMILES | CCN1C(=O)/C(=C\c2ccc(OC)c(O[C@@H]3C[C@@H]4CCC3C4)c2)c2cc(OC3CCCC3)ccc21 |
| InChI | InChI=1S/C30H35NO4/c1-3-31-26-12-11-23(34-22-6-4-5-7-22)18-24(26)25(30(31)32)15-20-9-13-27(33-2)29(17-20)35-28-16-19-8-10-21(28)14-19/h9,11-13,15,17-19,21-22,28H,3-8,10,14,16H2,1-2H3/b25-15-/t19-,21?,28-/m1/s1 |
| InChIKey | RJKSZTJUDWGOBZ-VDSRACPPSA-N |
| XLogP | 6.49 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|