C19H23NO3 — CID 91420731
3-[3-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]iminocyclopentan-1-one (PubChem CID 91420731) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-[3-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]iminocyclopentan-1-one.
| Compound Name | 3-[3-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]iminocyclopentan-1-one |
|---|---|
| PubChem CID | 91420731 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 3-[3-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]iminocyclopentan-1-one |
| SMILES | COc1ccc(/N=C2/CCC(=O)C2)cc1O[C@@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C19H23NO3/c1-22-17-7-5-15(20-14-4-6-16(21)10-14)11-19(17)23-18-9-12-2-3-13(18)8-12/h5,7,11-13,18H,2-4,6,8-10H2,1H3/b20-14-/t12-,13+,18+/m0/s1 |
| InChIKey | ITNVSOWSYXEQBT-YOMSXJRUSA-N |
| XLogP | 4.09 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|