C25H27NO4 — CID 15818837
(3Z)-3-[[3-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]methylidene]-5-methoxy-1-methylindol-2-one (PubChem CID 15818837) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is (3Z)-3-[[3-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]methylidene]-5-methoxy-1-methylindol-2-one.
| Compound Name | (3Z)-3-[[3-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]methylidene]-5-methoxy-1-methylindol-2-one |
|---|---|
| PubChem CID | 15818837 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (3Z)-3-[[3-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]methylidene]-5-methoxy-1-methylindol-2-one |
| SMILES | COc1ccc2c(c1)/C(=C/c1ccc(OC)c(O[C@H]3C[C@@H]4CC[C@H]3C4)c1)C(=O)N2C |
| InChI | InChI=1S/C25H27NO4/c1-26-21-8-7-18(28-2)14-19(21)20(25(26)27)11-16-5-9-22(29-3)24(13-16)30-23-12-15-4-6-17(23)10-15/h5,7-9,11,13-15,17,23H,4,6,10,12H2,1-3H3/b20-11-/t15-,17+,23+/m1/s1 |
| InChIKey | JVQIJLBCMOVOHW-MPQRVAHYSA-N |
| XLogP | 4.79 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|