C24H26N2O3 — CID 70207603
(3Z)-5-amino-3-[[3-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]methylidene]-1-methylindol-2-one (PubChem CID 70207603) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is (3Z)-5-amino-3-[[3-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]methylidene]-1-methylindol-2-one.
| Compound Name | (3Z)-5-amino-3-[[3-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]methylidene]-1-methylindol-2-one |
|---|---|
| PubChem CID | 70207603 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (3Z)-5-amino-3-[[3-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]oxy]-4-methoxyphenyl]methylidene]-1-methylindol-2-one |
| SMILES | COc1ccc(/C=C2\C(=O)N(C)c3ccc(N)cc32)cc1O[C@H]1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C24H26N2O3/c1-26-20-7-6-17(25)13-18(20)19(24(26)27)10-15-4-8-21(28-2)23(12-15)29-22-11-14-3-5-16(22)9-14/h4,6-8,10,12-14,16,22H,3,5,9,11,25H2,1-2H3/b19-10-/t14-,16+,22+/m1/s1 |
| InChIKey | XDGPGMWDPQWAGJ-IBRQTVHJSA-N |
| XLogP | 4.36 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|