C23H29BrN2 — CID 142044878
1-(4-bromophenyl)-4-(4-propan-2-ylphenyl)piperazine;buta-1,3-diene (PubChem CID 142044878) has the molecular formula C23H29BrN2 and a molecular weight of 413.40 g/mol. Its IUPAC name is 1-(4-bromophenyl)-4-(4-propan-2-ylphenyl)piperazine;buta-1,3-diene.
| Compound Name | 1-(4-bromophenyl)-4-(4-propan-2-ylphenyl)piperazine;buta-1,3-diene |
|---|---|
| PubChem CID | 142044878 |
| Molecular Formula | C23H29BrN2 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 1-(4-bromophenyl)-4-(4-propan-2-ylphenyl)piperazine;buta-1,3-diene |
| SMILES | C=CC=C.CC(C)c1ccc(N2CCN(c3ccc(Br)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H23BrN2.C4H6/c1-15(2)16-3-7-18(8-4-16)21-11-13-22(14-12-21)19-9-5-17(20)6-10-19;1-3-4-2/h3-10,15H,11-14H2,1-2H3;3-4H,1-2H2 |
| InChIKey | STEZYXMITNMWRT-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|