C15H24N2OS — CID 157423140
methyl-methylidene-oxo-[4-(4-propan-2-ylphenyl)piperazin-1-yl]-λ6-sulfane (PubChem CID 157423140) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is methyl-methylidene-oxo-[4-(4-propan-2-ylphenyl)piperazin-1-yl]-λ6-sulfane.
| Compound Name | methyl-methylidene-oxo-[4-(4-propan-2-ylphenyl)piperazin-1-yl]-λ6-sulfane |
|---|---|
| PubChem CID | 157423140 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | methyl-methylidene-oxo-[4-(4-propan-2-ylphenyl)piperazin-1-yl]-λ6-sulfane |
| SMILES | C=S(C)(=O)N1CCN(c2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C15H24N2OS/c1-13(2)14-5-7-15(8-6-14)16-9-11-17(12-10-16)19(3,4)18/h5-8,13H,3,9-12H2,1-2,4H3 |
| InChIKey | RXHQVVXWFQAEGQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|