C16H26F3NO — CID 142047078
ethane;(3Z,5Z)-4-ethylocta-1,3,5,7-tetraene;2,2,2-trifluoro-N,N-dimethylacetamide (PubChem CID 142047078) has the molecular formula C16H26F3NO and a molecular weight of 305.38 g/mol. Its IUPAC name is ethane;(3Z,5Z)-4-ethylocta-1,3,5,7-tetraene;2,2,2-trifluoro-N,N-dimethylacetamide.
| Compound Name | ethane;(3Z,5Z)-4-ethylocta-1,3,5,7-tetraene;2,2,2-trifluoro-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 142047078 |
| Molecular Formula | C16H26F3NO |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | ethane;(3Z,5Z)-4-ethylocta-1,3,5,7-tetraene;2,2,2-trifluoro-N,N-dimethylacetamide |
| SMILES | C=C/C=C\C(=C/C=C)CC.CC.CN(C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H14.C4H6F3NO.C2H6/c1-4-7-9-10(6-3)8-5-2;1-8(2)3(9)4(5,6)7;1-2/h4-5,7-9H,1-2,6H2,3H3;1-2H3;1-2H3/b9-7-,10-8-;; |
| InChIKey | YWBZWYAXMJVSGC-RXRQIEPESA-N |
| XLogP | 4.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|