C21H30F3N3 — CID 142047558
(2E,4E)-6-[6-(methylamino)hexylimino]-4-[3-(trifluoromethyl)phenyl]hepta-2,4-dien-2-amine (PubChem CID 142047558) has the molecular formula C21H30F3N3 and a molecular weight of 381.49 g/mol. Its IUPAC name is (2E,4E)-6-[6-(methylamino)hexylimino]-4-[3-(trifluoromethyl)phenyl]hepta-2,4-dien-2-amine.
| Compound Name | (2E,4E)-6-[6-(methylamino)hexylimino]-4-[3-(trifluoromethyl)phenyl]hepta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 142047558 |
| Molecular Formula | C21H30F3N3 |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | (2E,4E)-6-[6-(methylamino)hexylimino]-4-[3-(trifluoromethyl)phenyl]hepta-2,4-dien-2-amine |
| SMILES | CNCCCCCC/N=C(C)/C=C(\C=C(/C)N)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H30F3N3/c1-16(25)13-19(18-9-8-10-20(15-18)21(22,23)24)14-17(2)27-12-7-5-4-6-11-26-3/h8-10,13-15,26H,4-7,11-12,25H2,1-3H3/b16-13+,19-14+,27-17+ |
| InChIKey | NGDIWXPXISKNQE-AXYOQBBISA-N |
| XLogP | 5.19 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|