C10H9F3N2 — CID 57077686
4-[3-(trifluoromethyl)phenyl]-2,5-dihydro-1H-imidazole (PubChem CID 57077686) has the molecular formula C10H9F3N2 and a molecular weight of 214.19 g/mol. Its IUPAC name is 4-[3-(trifluoromethyl)phenyl]-2,5-dihydro-1H-imidazole.
| Compound Name | 4-[3-(trifluoromethyl)phenyl]-2,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 57077686 |
| Molecular Formula | C10H9F3N2 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 4-[3-(trifluoromethyl)phenyl]-2,5-dihydro-1H-imidazole |
| SMILES | FC(F)(F)c1cccc(C2=NCNC2)c1 |
| InChI | InChI=1S/C10H9F3N2/c11-10(12,13)8-3-1-2-7(4-8)9-5-14-6-15-9/h1-4,14H,5-6H2 |
| InChIKey | FXOMLZJKNCTHRN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |