C11H10F3N3 — CID 64690530
6-[3-(trifluoromethyl)phenyl]-4,5-dihydropyridazin-3-amine (PubChem CID 64690530) has the molecular formula C11H10F3N3 and a molecular weight of 241.22 g/mol. Its IUPAC name is 6-[3-(trifluoromethyl)phenyl]-4,5-dihydropyridazin-3-amine.
| Compound Name | 6-[3-(trifluoromethyl)phenyl]-4,5-dihydropyridazin-3-amine |
|---|---|
| PubChem CID | 64690530 |
| Molecular Formula | C11H10F3N3 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 6-[3-(trifluoromethyl)phenyl]-4,5-dihydropyridazin-3-amine |
| SMILES | NC1=NN=C(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C11H10F3N3/c12-11(13,14)8-3-1-2-7(6-8)9-4-5-10(15)17-16-9/h1-3,6H,4-5H2,(H2,15,17) |
| InChIKey | FTKFLSXEQIWBIV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |