C27H38F2N2 — CID 142047576
1-cyclopenta-1,3-dien-1-yl-N-methylethanimine;(2E,4E)-4-[4-(2,2-difluoropropyl)phenyl]-6-methylhepta-2,4,6-trien-2-amine;ethane (PubChem CID 142047576) has the molecular formula C27H38F2N2 and a molecular weight of 428.61 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-N-methylethanimine;(2E,4E)-4-[4-(2,2-difluoropropyl)phenyl]-6-methylhepta-2,4,6-trien-2-amine;ethane.
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-N-methylethanimine;(2E,4E)-4-[4-(2,2-difluoropropyl)phenyl]-6-methylhepta-2,4,6-trien-2-amine;ethane |
|---|---|
| PubChem CID | 142047576 |
| Molecular Formula | C27H38F2N2 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-N-methylethanimine;(2E,4E)-4-[4-(2,2-difluoropropyl)phenyl]-6-methylhepta-2,4,6-trien-2-amine;ethane |
| SMILES | C/N=C(\C)C1=CC=CC1.C=C(C)/C=C(\C=C(/C)N)c1ccc(CC(C)(F)F)cc1.CC |
| InChI | InChI=1S/C17H21F2N.C8H11N.C2H6/c1-12(2)9-16(10-13(3)20)15-7-5-14(6-8-15)11-17(4,18)19;1-7(9-2)8-5-3-4-6-8;1-2/h5-10H,1,11,20H2,2-4H3;3-5H,6H2,1-2H3;1-2H3/b13-10+,16-9+;9-7+; |
| InChIKey | OHIXXKJTQKZQQR-FCNWFXRUSA-N |
| XLogP | 7.70 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|