C14H24N2O2 — CID 142049065
(2E,3E)-1-[(3S)-3-aminopyrrolidin-1-yl]-2-ethylidene-4-hydroxyhexa-3,5-dien-1-one;ethane (PubChem CID 142049065) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (2E,3E)-1-[(3S)-3-aminopyrrolidin-1-yl]-2-ethylidene-4-hydroxyhexa-3,5-dien-1-one;ethane.
| Compound Name | (2E,3E)-1-[(3S)-3-aminopyrrolidin-1-yl]-2-ethylidene-4-hydroxyhexa-3,5-dien-1-one;ethane |
|---|---|
| PubChem CID | 142049065 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | (2E,3E)-1-[(3S)-3-aminopyrrolidin-1-yl]-2-ethylidene-4-hydroxyhexa-3,5-dien-1-one;ethane |
| SMILES | C=C/C(O)=C\C(=C/C)C(=O)N1CC[C@H](N)C1.CC |
| InChI | InChI=1S/C12H18N2O2.C2H6/c1-3-9(7-11(15)4-2)12(16)14-6-5-10(13)8-14;1-2/h3-4,7,10,15H,2,5-6,8,13H2,1H3;1-2H3/b9-3+,11-7+;/t10-;/m0./s1 |
| InChIKey | PTERJPDIHOYIDP-GLTYKBAPSA-N |
| XLogP | 2.15 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|