C25H25FN4O2 — CID 142050426
6-fluoro-3-[4-[3-(4-pyridin-2-ylpiperazin-1-yl)propoxy]phenyl]-1,2-benzoxazole (PubChem CID 142050426) has the molecular formula C25H25FN4O2 and a molecular weight of 432.50 g/mol. Its IUPAC name is 6-fluoro-3-[4-[3-(4-pyridin-2-ylpiperazin-1-yl)propoxy]phenyl]-1,2-benzoxazole.
| Compound Name | 6-fluoro-3-[4-[3-(4-pyridin-2-ylpiperazin-1-yl)propoxy]phenyl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 142050426 |
| Molecular Formula | C25H25FN4O2 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 6-fluoro-3-[4-[3-(4-pyridin-2-ylpiperazin-1-yl)propoxy]phenyl]-1,2-benzoxazole |
| SMILES | Fc1ccc2c(-c3ccc(OCCCN4CCN(c5ccccn5)CC4)cc3)noc2c1 |
| InChI | InChI=1S/C25H25FN4O2/c26-20-7-10-22-23(18-20)32-28-25(22)19-5-8-21(9-6-19)31-17-3-12-29-13-15-30(16-14-29)24-4-1-2-11-27-24/h1-2,4-11,18H,3,12-17H2 |
| InChIKey | DTXVZPZHGOJZFP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|