C10H20N2 — CID 142053760
1-but-1-en-2-yl-4-methyl-1,4-diazepane (PubChem CID 142053760) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-but-1-en-2-yl-4-methyl-1,4-diazepane.
| Compound Name | 1-but-1-en-2-yl-4-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 142053760 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1-but-1-en-2-yl-4-methyl-1,4-diazepane |
| SMILES | C=C(CC)N1CCCN(C)CC1 |
| InChI | InChI=1S/C10H20N2/c1-4-10(2)12-7-5-6-11(3)8-9-12/h2,4-9H2,1,3H3 |
| InChIKey | KKRWVXVBFZZSDL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |