About N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane
N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane (PubChem CID 142053880) has the molecular formula C20H35N
and a molecular weight of 289.51 g/mol. Its IUPAC name is N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane.
Molecular Properties
| Compound Name | N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane |
| PubChem CID | 142053880 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane |
| SMILES | C=C(CCCC(C)(C)c1ccccc1)CCNC.CCC |
| InChI | InChI=1S/C17H27N.C3H8/c1-15(12-14-18-4)9-8-13-17(2,3)16-10-6-5-7-11-16;1-3-2/h5-7,10-11,18H,1,8-9,12-14H2,2-4H3;3H2,1-2H3 |
| InChIKey | RYSPLCIZZWAJGJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane?
The IUPAC name of N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane (CID 142053880) is N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane.
What is the SMILES notation for N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane?
The canonical SMILES for N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane is C=C(CCCC(C)(C)c1ccccc1)CCNC.CCC.
What is the InChIKey of N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane?
The InChIKey is RYSPLCIZZWAJGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N.C3H8/c1-15(12-14-18-4)9-8-13-17(2,3)16-10-6-5-7-11-16;1-3-2/h5-7,10-11,18H,1,8-9,12-14H2,2-4H3;3H2,1-2H3.
What are the key properties of N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane?
N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane has a molecular weight of 289.51 g/mol, XLogP of 5.72, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane is sourced from PubChem (CID 142053880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).