C20H35N — CID 142053880
N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane (PubChem CID 142053880) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane.
| Compound Name | N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane |
|---|---|
| PubChem CID | 142053880 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | N,7-dimethyl-3-methylidene-7-phenyloctan-1-amine;propane |
| SMILES | C=C(CCCC(C)(C)c1ccccc1)CCNC.CCC |
| InChI | InChI=1S/C17H27N.C3H8/c1-15(12-14-18-4)9-8-13-17(2,3)16-10-6-5-7-11-16;1-3-2/h5-7,10-11,18H,1,8-9,12-14H2,2-4H3;3H2,1-2H3 |
| InChIKey | RYSPLCIZZWAJGJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|