C22H32F3NO — CID 162407872
2,2,2-trifluoro-N-(4-methyl-6-methylidene-4-phenyldodecyl)acetamide (PubChem CID 162407872) has the molecular formula C22H32F3NO and a molecular weight of 383.50 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(4-methyl-6-methylidene-4-phenyldodecyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(4-methyl-6-methylidene-4-phenyldodecyl)acetamide |
|---|---|
| PubChem CID | 162407872 |
| Molecular Formula | C22H32F3NO |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 2,2,2-trifluoro-N-(4-methyl-6-methylidene-4-phenyldodecyl)acetamide |
| SMILES | C=C(CCCCCC)CC(C)(CCCNC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C22H32F3NO/c1-4-5-6-8-12-18(2)17-21(3,19-13-9-7-10-14-19)15-11-16-26-20(27)22(23,24)25/h7,9-10,13-14H,2,4-6,8,11-12,15-17H2,1,3H3,(H,26,27) |
| InChIKey | ZTSQONHALLJCIC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|