C21H32N2O4 — CID 162388155
(3R)-3-methyl-3-(octanoylamino)-4-oxo-4-(2-phenylethylamino)butanoic acid (PubChem CID 162388155) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is (3R)-3-methyl-3-(octanoylamino)-4-oxo-4-(2-phenylethylamino)butanoic acid.
| Compound Name | (3R)-3-methyl-3-(octanoylamino)-4-oxo-4-(2-phenylethylamino)butanoic acid |
|---|---|
| PubChem CID | 162388155 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (3R)-3-methyl-3-(octanoylamino)-4-oxo-4-(2-phenylethylamino)butanoic acid |
| SMILES | CCCCCCCC(=O)N[C@](C)(CC(=O)O)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C21H32N2O4/c1-3-4-5-6-10-13-18(24)23-21(2,16-19(25)26)20(27)22-15-14-17-11-8-7-9-12-17/h7-9,11-12H,3-6,10,13-16H2,1-2H3,(H,22,27)(H,23,24)(H,25,26)/t21-/m1/s1 |
| InChIKey | DPHFQTFUMKNFNO-OAQYLSRUSA-N |
| XLogP | 3.06 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|