C22H36N4O3 — CID 170222080
2-(decanoylamino)-2-methyl-N-(2-pyridin-2-ylethyl)butanediamide (PubChem CID 170222080) has the molecular formula C22H36N4O3 and a molecular weight of 404.56 g/mol. Its IUPAC name is 2-(decanoylamino)-2-methyl-N-(2-pyridin-2-ylethyl)butanediamide.
| Compound Name | 2-(decanoylamino)-2-methyl-N-(2-pyridin-2-ylethyl)butanediamide |
|---|---|
| PubChem CID | 170222080 |
| Molecular Formula | C22H36N4O3 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 2-(decanoylamino)-2-methyl-N-(2-pyridin-2-ylethyl)butanediamide |
| SMILES | CCCCCCCCCC(=O)NC(C)(CC(N)=O)C(=O)NCCc1ccccn1 |
| InChI | InChI=1S/C22H36N4O3/c1-3-4-5-6-7-8-9-13-20(28)26-22(2,17-19(23)27)21(29)25-16-14-18-12-10-11-15-24-18/h10-12,15H,3-9,13-14,16-17H2,1-2H3,(H2,23,27)(H,25,29)(H,26,28) |
| InChIKey | UDIWLVUOJNCGNF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|