C74H26O — CID 161010051
hexaconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,34,36,38,40,42,44,46,48,50,52,54,56,58-nonacosayne;6-methyl-6-phenylheptan-2-one (PubChem CID 161010051) has the molecular formula C74H26O and a molecular weight of 931.02 g/mol. Its IUPAC name is hexaconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,34,36,38,40,42,44,46,48,50,52,54,56,58-nonacosayne;6-methyl-6-phenylheptan-2-one.
| Compound Name | hexaconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,34,36,38,40,42,44,46,48,50,52,54,56,58-nonacosayne;6-methyl-6-phenylheptan-2-one |
|---|---|
| PubChem CID | 161010051 |
| Molecular Formula | C74H26O |
| Molecular Weight | 931.02 g/mol |
| Exact Mass | 930.20 |
| IUPAC Name | hexaconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,34,36,38,40,42,44,46,48,50,52,54,56,58-nonacosayne;6-methyl-6-phenylheptan-2-one |
| SMILES | CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC.CC(=O)CCCC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C60H6.C14H20O/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-43-45-47-49-51-53-55-57-59-60-58-56-54-52-50-48-46-44-42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;1-12(15)8-7-11-14(2,3)13-9-5-4-6-10-13/h1-2H3;4-6,9-10H,7-8,11H2,1-3H3 |
| InChIKey | TXAAPBLMPTWJLF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 75 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.02 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|