C21H13N5O2S — CID 142055117
2-amino-4-(4-nitrosophenyl)-6-(2-oxo-1-phenylethyl)sulfanylpyridine-3,5-dicarbonitrile (PubChem CID 142055117) has the molecular formula C21H13N5O2S and a molecular weight of 399.44 g/mol. Its IUPAC name is 2-amino-4-(4-nitrosophenyl)-6-(2-oxo-1-phenylethyl)sulfanylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(4-nitrosophenyl)-6-(2-oxo-1-phenylethyl)sulfanylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 142055117 |
| Molecular Formula | C21H13N5O2S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 2-amino-4-(4-nitrosophenyl)-6-(2-oxo-1-phenylethyl)sulfanylpyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)nc(SC(C=O)c2ccccc2)c(C#N)c1-c1ccc(N=O)cc1 |
| InChI | InChI=1S/C21H13N5O2S/c22-10-16-19(14-6-8-15(26-28)9-7-14)17(11-23)21(25-20(16)24)29-18(12-27)13-4-2-1-3-5-13/h1-9,12,18H,(H2,24,25) |
| InChIKey | FYDTZIPPXBWEPS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|