C19H32O2 — CID 142056536
propane;2',2',5,5-tetramethylspiro[1,3-dioxane-2,6'-5,7-dihydro-4H-indene] (PubChem CID 142056536) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is propane;2',2',5,5-tetramethylspiro[1,3-dioxane-2,6'-5,7-dihydro-4H-indene].
| Compound Name | propane;2',2',5,5-tetramethylspiro[1,3-dioxane-2,6'-5,7-dihydro-4H-indene] |
|---|---|
| PubChem CID | 142056536 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | propane;2',2',5,5-tetramethylspiro[1,3-dioxane-2,6'-5,7-dihydro-4H-indene] |
| SMILES | CC1(C)C=C2CCC3(CC2=C1)OCC(C)(C)CO3.CCC |
| InChI | InChI=1S/C16H24O2.C3H8/c1-14(2)7-12-5-6-16(9-13(12)8-14)17-10-15(3,4)11-18-16;1-3-2/h7-8H,5-6,9-11H2,1-4H3;3H2,1-2H3 |
| InChIKey | UGOJTWKOFAQUMT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |