About ethane;7-pentan-2-yl-3H-azepine
ethane;7-pentan-2-yl-3H-azepine (PubChem CID 142057670) has the molecular formula C15H29N
and a molecular weight of 223.40 g/mol. Its IUPAC name is ethane;7-pentan-2-yl-3H-azepine.
Molecular Properties
| Compound Name | ethane;7-pentan-2-yl-3H-azepine |
| PubChem CID | 142057670 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | ethane;7-pentan-2-yl-3H-azepine |
| SMILES | CC.CC.CCCC(C)C1=CC=CCC=N1 |
| InChI | InChI=1S/C11H17N.2C2H6/c1-3-7-10(2)11-8-5-4-6-9-12-11;2*1-2/h4-5,8-10H,3,6-7H2,1-2H3;2*1-2H3 |
| InChIKey | AWIDTRSUEUKVNG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;7-pentan-2-yl-3H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-pentan-2-yl-3H-azepine?
The IUPAC name of ethane;7-pentan-2-yl-3H-azepine (CID 142057670) is ethane;7-pentan-2-yl-3H-azepine.
What is the SMILES notation for ethane;7-pentan-2-yl-3H-azepine?
The canonical SMILES for ethane;7-pentan-2-yl-3H-azepine is CC.CC.CCCC(C)C1=CC=CCC=N1.
What is the InChIKey of ethane;7-pentan-2-yl-3H-azepine?
The InChIKey is AWIDTRSUEUKVNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N.2C2H6/c1-3-7-10(2)11-8-5-4-6-9-12-11;2*1-2/h4-5,8-10H,3,6-7H2,1-2H3;2*1-2H3.
What are the key properties of ethane;7-pentan-2-yl-3H-azepine?
ethane;7-pentan-2-yl-3H-azepine has a molecular weight of 223.40 g/mol, XLogP of 5.39, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-pentan-2-yl-3H-azepine is sourced from PubChem (CID 142057670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).