C13H22N2 — CID 91042445
3,5,7-trimethyl-5-(3-methylbutyl)-1,4-diazepine (PubChem CID 91042445) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 3,5,7-trimethyl-5-(3-methylbutyl)-1,4-diazepine.
| Compound Name | 3,5,7-trimethyl-5-(3-methylbutyl)-1,4-diazepine |
|---|---|
| PubChem CID | 91042445 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 3,5,7-trimethyl-5-(3-methylbutyl)-1,4-diazepine |
| SMILES | CC1=CC(C)(CCC(C)C)N=C(C)C=N1 |
| InChI | InChI=1S/C13H22N2/c1-10(2)6-7-13(5)8-11(3)14-9-12(4)15-13/h8-10H,6-7H2,1-5H3 |
| InChIKey | ICIUVGIAAPZDOP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |