About 4-aminooxolan-3-olate;rubidium(1+)
4-aminooxolan-3-olate;rubidium(1+) (PubChem CID 142060066) has the molecular formula C4H8NO2Rb
and a molecular weight of 187.58 g/mol. Its IUPAC name is 4-aminooxolan-3-olate;rubidium(1+).
Molecular Properties
| Compound Name | 4-aminooxolan-3-olate;rubidium(1+) |
| PubChem CID | 142060066 |
| Molecular Formula | C4H8NO2Rb |
| Molecular Weight | 187.58 g/mol |
| Exact Mass | 186.97 |
| IUPAC Name | 4-aminooxolan-3-olate;rubidium(1+) |
| SMILES | NC1COCC1[O-].[Rb+] |
| InChI | InChI=1S/C4H8NO2.Rb/c5-3-1-7-2-4(3)6;/h3-4H,1-2,5H2;/q-1;+1 |
| InChIKey | ZSBMLCPULMYEAR-UHFFFAOYSA-N |
| XLogP | -4.92 |
| TPSA | 58.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.58 |
| LogP ≤ 5 | -4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-aminooxolan-3-olate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminooxolan-3-olate;rubidium(1+)?
The IUPAC name of 4-aminooxolan-3-olate;rubidium(1+) (CID 142060066) is 4-aminooxolan-3-olate;rubidium(1+).
What is the SMILES notation for 4-aminooxolan-3-olate;rubidium(1+)?
The canonical SMILES for 4-aminooxolan-3-olate;rubidium(1+) is NC1COCC1[O-].[Rb+].
What is the InChIKey of 4-aminooxolan-3-olate;rubidium(1+)?
The InChIKey is ZSBMLCPULMYEAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8NO2.Rb/c5-3-1-7-2-4(3)6;/h3-4H,1-2,5H2;/q-1;+1.
What are the key properties of 4-aminooxolan-3-olate;rubidium(1+)?
4-aminooxolan-3-olate;rubidium(1+) has a molecular weight of 187.58 g/mol, XLogP of -4.92, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminooxolan-3-olate;rubidium(1+) is sourced from PubChem (CID 142060066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).