C5H11NOS — CID 97303608
(3R,4S)-4-methylsulfanyloxolan-3-amine (PubChem CID 97303608) has the molecular formula C5H11NOS and a molecular weight of 133.22 g/mol. Its IUPAC name is (3R,4S)-4-methylsulfanyloxolan-3-amine.
| Compound Name | (3R,4S)-4-methylsulfanyloxolan-3-amine |
|---|---|
| PubChem CID | 97303608 |
| Molecular Formula | C5H11NOS |
| Molecular Weight | 133.22 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | (3R,4S)-4-methylsulfanyloxolan-3-amine |
| SMILES | CS[C@@H]1COC[C@H]1N |
| InChI | InChI=1S/C5H11NOS/c1-8-5-3-7-2-4(5)6/h4-5H,2-3,6H2,1H3/t4-,5-/m1/s1 |
| InChIKey | PGEVHBGKXCWEJD-RFZPGFLSSA-N |
| XLogP | 0.08 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.22 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |