C7H14S — CID 123969276
1,2-dimethyl-3-methylsulfanylcyclobutane (PubChem CID 123969276) has the molecular formula C7H14S and a molecular weight of 130.26 g/mol. Its IUPAC name is 1,2-dimethyl-3-methylsulfanylcyclobutane.
| Compound Name | 1,2-dimethyl-3-methylsulfanylcyclobutane |
|---|---|
| PubChem CID | 123969276 |
| Molecular Formula | C7H14S |
| Molecular Weight | 130.26 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | 1,2-dimethyl-3-methylsulfanylcyclobutane |
| SMILES | CSC1CC(C)C1C |
| InChI | InChI=1S/C7H14S/c1-5-4-7(8-3)6(5)2/h5-7H,4H2,1-3H3 |
| InChIKey | MSEPHMUGOHVVHV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |