About 1,2,4-trimethyl-3,5-bis(methylsulfanyl)cyclohexane
1,2,4-trimethyl-3,5-bis(methylsulfanyl)cyclohexane (PubChem CID 21044094) has the molecular formula C11H22S2
and a molecular weight of 218.43 g/mol. Its IUPAC name is 1,2,4-trimethyl-3,5-bis(methylsulfanyl)cyclohexane.
Analyze 1,2,4-trimethyl-3,5-bis(methylsulfanyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-trimethyl-3,5-bis(methylsulfanyl)cyclohexane?
The IUPAC name of 1,2,4-trimethyl-3,5-bis(methylsulfanyl)cyclohexane (CID 21044094) is 1,2,4-trimethyl-3,5-bis(methylsulfanyl)cyclohexane.
What is the SMILES notation for 1,2,4-trimethyl-3,5-bis(methylsulfanyl)cyclohexane?
The canonical SMILES for 1,2,4-trimethyl-3,5-bis(methylsulfanyl)cyclohexane is CSC1CC(C)C(C)C(SC)C1C.
What is the InChIKey of 1,2,4-trimethyl-3,5-bis(methylsulfanyl)cyclohexane?
The InChIKey is PYOLAEIUSNTFOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22S2/c1-7-6-10(12-4)9(3)11(13-5)8(7)2/h7-11H,6H2,1-5H3.
What are the key properties of 1,2,4-trimethyl-3,5-bis(methylsulfanyl)cyclohexane?
1,2,4-trimethyl-3,5-bis(methylsulfanyl)cyclohexane has a molecular weight of 218.43 g/mol, XLogP of 3.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-trimethyl-3,5-bis(methylsulfanyl)cyclohexane is sourced from PubChem (CID 21044094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).