C21H21N3O4 — CID 142063358
2-[3-[(2-formylimidazol-1-yl)methyl]-2-methylphenoxy]ethyl N-phenylcarbamate (PubChem CID 142063358) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-[3-[(2-formylimidazol-1-yl)methyl]-2-methylphenoxy]ethyl N-phenylcarbamate.
| Compound Name | 2-[3-[(2-formylimidazol-1-yl)methyl]-2-methylphenoxy]ethyl N-phenylcarbamate |
|---|---|
| PubChem CID | 142063358 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-[3-[(2-formylimidazol-1-yl)methyl]-2-methylphenoxy]ethyl N-phenylcarbamate |
| SMILES | Cc1c(Cn2ccnc2C=O)cccc1OCCOC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H21N3O4/c1-16-17(14-24-11-10-22-20(24)15-25)6-5-9-19(16)27-12-13-28-21(26)23-18-7-3-2-4-8-18/h2-11,15H,12-14H2,1H3,(H,23,26) |
| InChIKey | NIKKDKBXAHZBIP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|