C12H21FN2 — CID 142063945
(5E)-6-fluoro-1-N,1-N,2-N-trimethyl-4-methylideneocta-5,7-diene-1,2-diamine (PubChem CID 142063945) has the molecular formula C12H21FN2 and a molecular weight of 212.31 g/mol. Its IUPAC name is (5E)-6-fluoro-1-N,1-N,2-N-trimethyl-4-methylideneocta-5,7-diene-1,2-diamine.
| Compound Name | (5E)-6-fluoro-1-N,1-N,2-N-trimethyl-4-methylideneocta-5,7-diene-1,2-diamine |
|---|---|
| PubChem CID | 142063945 |
| Molecular Formula | C12H21FN2 |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | (5E)-6-fluoro-1-N,1-N,2-N-trimethyl-4-methylideneocta-5,7-diene-1,2-diamine |
| SMILES | C=C/C(F)=C\C(=C)CC(CN(C)C)NC |
| InChI | InChI=1S/C12H21FN2/c1-6-11(13)7-10(2)8-12(14-3)9-15(4)5/h6-7,12,14H,1-2,8-9H2,3-5H3/b11-7+ |
| InChIKey | SVEYOSOVAWDKFH-YRNVUSSQSA-N |
| XLogP | 2.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|