C21H36N4O2 — CID 142066823
N-[4-[(3S)-2-methylidene-5-oxo-9-prop-2-enyl-1-propyl-1,4,9-triazaspiro[5.5]undecan-3-yl]butyl]acetamide (PubChem CID 142066823) has the molecular formula C21H36N4O2 and a molecular weight of 376.55 g/mol. Its IUPAC name is N-[4-[(3S)-2-methylidene-5-oxo-9-prop-2-enyl-1-propyl-1,4,9-triazaspiro[5.5]undecan-3-yl]butyl]acetamide.
| Compound Name | N-[4-[(3S)-2-methylidene-5-oxo-9-prop-2-enyl-1-propyl-1,4,9-triazaspiro[5.5]undecan-3-yl]butyl]acetamide |
|---|---|
| PubChem CID | 142066823 |
| Molecular Formula | C21H36N4O2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | N-[4-[(3S)-2-methylidene-5-oxo-9-prop-2-enyl-1-propyl-1,4,9-triazaspiro[5.5]undecan-3-yl]butyl]acetamide |
| SMILES | C=CCN1CCC2(CC1)C(=O)N[C@@H](CCCCNC(C)=O)C(=C)N2CCC |
| InChI | InChI=1S/C21H36N4O2/c1-5-13-24-15-10-21(11-16-24)20(27)23-19(17(3)25(21)14-6-2)9-7-8-12-22-18(4)26/h5,19H,1,3,6-16H2,2,4H3,(H,22,26)(H,23,27)/t19-/m0/s1 |
| InChIKey | JCMVPIFTILDUPW-IBGZPJMESA-N |
| XLogP | 2.04 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|