C17H17N7O2 — CID 1420710
2-(3,5-dimethylpyrazol-1-yl)-6-methyl-N-[(2-nitrophenyl)methylideneamino]pyrimidin-4-amine (PubChem CID 1420710) has the molecular formula C17H17N7O2 and a molecular weight of 351.37 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-6-methyl-N-[(2-nitrophenyl)methylideneamino]pyrimidin-4-amine.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-6-methyl-N-[(2-nitrophenyl)methylideneamino]pyrimidin-4-amine |
|---|---|
| PubChem CID | 1420710 |
| Molecular Formula | C17H17N7O2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-6-methyl-N-[(2-nitrophenyl)methylideneamino]pyrimidin-4-amine |
| SMILES | Cc1cc(NN=Cc2ccccc2[N+](=O)[O-])nc(-n2nc(C)cc2C)n1 |
| InChI | InChI=1S/C17H17N7O2/c1-11-9-16(20-17(19-11)23-13(3)8-12(2)22-23)21-18-10-14-6-4-5-7-15(14)24(25)26/h4-10H,1-3H3,(H,19,20,21) |
| InChIKey | ZCVXYSHXJFVMBL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|