C14H21NO — CID 142071205
1-(4-ethenoxyphenyl)-2,3-dimethylbutan-2-amine (PubChem CID 142071205) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-(4-ethenoxyphenyl)-2,3-dimethylbutan-2-amine.
| Compound Name | 1-(4-ethenoxyphenyl)-2,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 142071205 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 1-(4-ethenoxyphenyl)-2,3-dimethylbutan-2-amine |
| SMILES | C=COc1ccc(CC(C)(N)C(C)C)cc1 |
| InChI | InChI=1S/C14H21NO/c1-5-16-13-8-6-12(7-9-13)10-14(4,15)11(2)3/h5-9,11H,1,10,15H2,2-4H3 |
| InChIKey | QGPZEWXDQINBAF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|