C44H46F2N3O5P — CID 142071479
(3-benzylphenyl)methyl 2-(benzotriazol-1-yl)-3-[4-[bis(2-methylpropoxy)phosphoryl-difluoromethyl]phenyl]-2-phenylpropanoate (PubChem CID 142071479) has the molecular formula C44H46F2N3O5P and a molecular weight of 765.84 g/mol. Its IUPAC name is (3-benzylphenyl)methyl 2-(benzotriazol-1-yl)-3-[4-[bis(2-methylpropoxy)phosphoryl-difluoromethyl]phenyl]-2-phenylpropanoate.
| Compound Name | (3-benzylphenyl)methyl 2-(benzotriazol-1-yl)-3-[4-[bis(2-methylpropoxy)phosphoryl-difluoromethyl]phenyl]-2-phenylpropanoate |
|---|---|
| PubChem CID | 142071479 |
| Molecular Formula | C44H46F2N3O5P |
| Molecular Weight | 765.84 g/mol |
| Exact Mass | 765.31 |
| IUPAC Name | (3-benzylphenyl)methyl 2-(benzotriazol-1-yl)-3-[4-[bis(2-methylpropoxy)phosphoryl-difluoromethyl]phenyl]-2-phenylpropanoate |
| SMILES | CC(C)COP(=O)(OCC(C)C)C(F)(F)c1ccc(CC(C(=O)OCc2cccc(Cc3ccccc3)c2)(c2ccccc2)n2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C44H46F2N3O5P/c1-32(2)29-53-55(51,54-30-33(3)4)44(45,46)39-24-22-35(23-25-39)28-43(38-18-9-6-10-19-38,49-41-21-12-11-20-40(41)47-48-49)42(50)52-31-37-17-13-16-36(27-37)26-34-14-7-5-8-15-34/h5-25,27,32-33H,26,28-31H2,1-4H3 |
| InChIKey | NPMMOCLVRCOFJZ-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.84 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|