C19H35N3O — CID 142071723
ethane;1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-8-methyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 142071723) has the molecular formula C19H35N3O and a molecular weight of 321.51 g/mol. Its IUPAC name is ethane;1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-8-methyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | ethane;1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-8-methyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 142071723 |
| Molecular Formula | C19H35N3O |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.28 |
| IUPAC Name | ethane;1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-8-methyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | C=C(/C=C\C=C/C)N1CNC(=O)C12CCN(C)CC2.CC.CC |
| InChI | InChI=1S/C15H23N3O.2C2H6/c1-4-5-6-7-13(2)18-12-16-14(19)15(18)8-10-17(3)11-9-15;2*1-2/h4-7H,2,8-12H2,1,3H3,(H,16,19);2*1-2H3/b5-4-,7-6-;; |
| InChIKey | QJPJUWYXWCNYTM-FCVIEVJZSA-N |
| XLogP | 3.54 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|