C15H23N3O — CID 142152590
1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-8-methyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 142152590) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-8-methyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-8-methyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 142152590 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-8-methyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | C=C/C=C(\C=C/C)N1CNC(=O)C12CCN(C)CC2 |
| InChI | InChI=1S/C15H23N3O/c1-4-6-13(7-5-2)18-12-16-14(19)15(18)8-10-17(3)11-9-15/h4-7H,1,8-12H2,2-3H3,(H,16,19)/b7-5-,13-6+ |
| InChIKey | PEUKMBPELFWING-IILXRZLBSA-N |
| XLogP | 1.49 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|